C21H23NO4 — CID 55570576
[2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 4-prop-2-enoxybenzoate (PubChem CID 55570576) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is [2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 4-prop-2-enoxybenzoate.
| Compound Name | [2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 55570576 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)OCC(=O)N(C)C(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-4-14-25-19-12-10-18(11-13-19)21(24)26-15-20(23)22(3)16(2)17-8-6-5-7-9-17/h4-13,16H,1,14-15H2,2-3H3 |
| InChIKey | OJQXHXPCCKTTAL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|