C22H23FN2O3 — CID 46814706
[1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 46814706) has the molecular formula C22H23FN2O3 and a molecular weight of 382.44 g/mol. Its IUPAC name is [1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | [1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 46814706 |
| Molecular Formula | C22H23FN2O3 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | [1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | Cc1[nH]c2ccc(C(=O)OC(C)C(=O)N(C)Cc3cccc(F)c3)cc2c1C |
| InChI | InChI=1S/C22H23FN2O3/c1-13-14(2)24-20-9-8-17(11-19(13)20)22(27)28-15(3)21(26)25(4)12-16-6-5-7-18(23)10-16/h5-11,15,24H,12H2,1-4H3 |
| InChIKey | LPBBEOSGKNLFMN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|