C20H23FN2O3 — CID 95788331
[(2S)-1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 3-amino-4-ethylbenzoate (PubChem CID 95788331) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is [(2S)-1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 3-amino-4-ethylbenzoate.
| Compound Name | [(2S)-1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 3-amino-4-ethylbenzoate |
|---|---|
| PubChem CID | 95788331 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | [(2S)-1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 3-amino-4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)O[C@@H](C)C(=O)N(C)Cc2cccc(F)c2)cc1N |
| InChI | InChI=1S/C20H23FN2O3/c1-4-15-8-9-16(11-18(15)22)20(25)26-13(2)19(24)23(3)12-14-6-5-7-17(21)10-14/h5-11,13H,4,12,22H2,1-3H3/t13-/m0/s1 |
| InChIKey | NRRAFRIVTJHYDK-ZDUSSCGKSA-N |
| XLogP | 3.17 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|