C20H20FN3OS — CID 46815747
N-[(4-fluorophenyl)methyl]-N-methyl-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide (PubChem CID 46815747) has the molecular formula C20H20FN3OS and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-methyl-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-methyl-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 46815747 |
| Molecular Formula | C20H20FN3OS |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-methyl-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide |
| SMILES | CN(Cc1ccc(F)cc1)C(=O)CSc1ncc(-c2ccccc2)n1C |
| InChI | InChI=1S/C20H20FN3OS/c1-23(13-15-8-10-17(21)11-9-15)19(25)14-26-20-22-12-18(24(20)2)16-6-4-3-5-7-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | LXEPTACDRDLELU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|