C18H25N3OS — CID 4681631
1-(2,3-dihydroindol-1-yl)-3-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)propan-1-one (PubChem CID 4681631) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-3-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)propan-1-one.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-3-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)propan-1-one |
|---|---|
| PubChem CID | 4681631 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-3-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)propan-1-one |
| SMILES | CC1CC(C)(C)NC(=S)N1CCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H25N3OS/c1-13-12-18(2,3)19-17(23)20(13)11-9-16(22)21-10-8-14-6-4-5-7-15(14)21/h4-7,13H,8-12H2,1-3H3,(H,19,23) |
| InChIKey | XXHMDKIVGVPYPS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|