C17H22BrN3O4 — CID 46820560
methyl 2-[1-[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 46820560) has the molecular formula C17H22BrN3O4 and a molecular weight of 412.28 g/mol. Its IUPAC name is methyl 2-[1-[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 46820560 |
| Molecular Formula | C17H22BrN3O4 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | methyl 2-[1-[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1CC(=O)NC(C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H22BrN3O4/c1-11(12-3-5-13(18)6-4-12)20-15(22)10-21-8-7-19-17(24)14(21)9-16(23)25-2/h3-6,11,14H,7-10H2,1-2H3,(H,19,24)(H,20,22) |
| InChIKey | CEZMKQJTWIJCJX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |