C21H21N3O3S2 — CID 46821750
3-(furan-2-ylmethyl)-7-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 46821750) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-7-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(furan-2-ylmethyl)-7-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 46821750 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 3-(furan-2-ylmethyl)-7-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc(CSc2nc3sc4c(c3c(=O)n2Cc2ccco2)CCC(C)C4)no1 |
| InChI | InChI=1S/C21H21N3O3S2/c1-12-5-6-16-17(8-12)29-19-18(16)20(25)24(10-15-4-3-7-26-15)21(22-19)28-11-14-9-13(2)27-23-14/h3-4,7,9,12H,5-6,8,10-11H2,1-2H3 |
| InChIKey | CCBUNTWMTDYTDU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |