C20H12Cl2N4S — CID 46822213
6-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanylmethyl]phenanthridine (PubChem CID 46822213) has the molecular formula C20H12Cl2N4S and a molecular weight of 411.32 g/mol. Its IUPAC name is 6-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanylmethyl]phenanthridine.
| Compound Name | 6-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanylmethyl]phenanthridine |
|---|---|
| PubChem CID | 46822213 |
| Molecular Formula | C20H12Cl2N4S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 6-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanylmethyl]phenanthridine |
| SMILES | Clc1cc(Cl)c2nnc(SCc3nc4ccccc4c4ccccc34)n2c1 |
| InChI | InChI=1S/C20H12Cl2N4S/c21-12-9-16(22)19-24-25-20(26(19)10-12)27-11-18-15-7-2-1-5-13(15)14-6-3-4-8-17(14)23-18/h1-10H,11H2 |
| InChIKey | VUDYHRQAJWGFDE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|