C24H29N3O6S — CID 46822567
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 3,4-dimethyl-5-(4-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 46822567) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3,4-dimethyl-5-(4-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3,4-dimethyl-5-(4-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 46822567 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3,4-dimethyl-5-(4-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | Cc1cc(C(=O)OCC(=O)NNC(=O)c2ccccc2)cc(S(=O)(=O)N2CCC(C)CC2)c1C |
| InChI | InChI=1S/C24H29N3O6S/c1-16-9-11-27(12-10-16)34(31,32)21-14-20(13-17(2)18(21)3)24(30)33-15-22(28)25-26-23(29)19-7-5-4-6-8-19/h4-8,13-14,16H,9-12,15H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | UVPWNTSVJASALY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|