C20H19N3O6 — CID 46824469
[2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-[(3-nitrobenzoyl)amino]acetate (PubChem CID 46824469) has the molecular formula C20H19N3O6 and a molecular weight of 397.39 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-[(3-nitrobenzoyl)amino]acetate.
| Compound Name | [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-[(3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 46824469 |
| Molecular Formula | C20H19N3O6 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-[(3-nitrobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1cccc([N+](=O)[O-])c1)OC(C(=O)NC1CC1)c1ccccc1 |
| InChI | InChI=1S/C20H19N3O6/c24-17(12-21-19(25)14-7-4-8-16(11-14)23(27)28)29-18(13-5-2-1-3-6-13)20(26)22-15-9-10-15/h1-8,11,15,18H,9-10,12H2,(H,21,25)(H,22,26) |
| InChIKey | SCSXJCBBDLQOMI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|