C20H17ClN2O2 — CID 46829230
(2-chlorophenyl) N-methyl-N-[(3-pyridin-4-ylphenyl)methyl]carbamate (PubChem CID 46829230) has the molecular formula C20H17ClN2O2 and a molecular weight of 352.82 g/mol. Its IUPAC name is (2-chlorophenyl) N-methyl-N-[(3-pyridin-4-ylphenyl)methyl]carbamate.
| Compound Name | (2-chlorophenyl) N-methyl-N-[(3-pyridin-4-ylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 46829230 |
| Molecular Formula | C20H17ClN2O2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (2-chlorophenyl) N-methyl-N-[(3-pyridin-4-ylphenyl)methyl]carbamate |
| SMILES | CN(Cc1cccc(-c2ccncc2)c1)C(=O)Oc1ccccc1Cl |
| InChI | InChI=1S/C20H17ClN2O2/c1-23(20(24)25-19-8-3-2-7-18(19)21)14-15-5-4-6-17(13-15)16-9-11-22-12-10-16/h2-13H,14H2,1H3 |
| InChIKey | NNMVBUUQSZHUBT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |