C13H9NO3 — CID 46830523
8-hydroxy-2-methyl-1H-benzo[f]indole-4,9-dione (PubChem CID 46830523) has the molecular formula C13H9NO3 and a molecular weight of 227.22 g/mol. Its IUPAC name is 8-hydroxy-2-methyl-1H-benzo[f]indole-4,9-dione.
| Compound Name | 8-hydroxy-2-methyl-1H-benzo[f]indole-4,9-dione |
|---|---|
| PubChem CID | 46830523 |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 8-hydroxy-2-methyl-1H-benzo[f]indole-4,9-dione |
| SMILES | Cc1cc2c([nH]1)C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C13H9NO3/c1-6-5-8-11(14-6)13(17)10-7(12(8)16)3-2-4-9(10)15/h2-5,14-15H,1H3 |
| InChIKey | DIDNTKIIMGYOJI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|