C17H18N2O4S — CID 46831084
3-(3-methoxyphenyl)-1-[2-[(2S)-oxiran-2-yl]ethyl]-2λ6,1,3-benzothiadiazole 2,2-dioxide (PubChem CID 46831084) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-1-[2-[(2S)-oxiran-2-yl]ethyl]-2λ6,1,3-benzothiadiazole 2,2-dioxide.
| Compound Name | 3-(3-methoxyphenyl)-1-[2-[(2S)-oxiran-2-yl]ethyl]-2λ6,1,3-benzothiadiazole 2,2-dioxide |
|---|---|
| PubChem CID | 46831084 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 3-(3-methoxyphenyl)-1-[2-[(2S)-oxiran-2-yl]ethyl]-2λ6,1,3-benzothiadiazole 2,2-dioxide |
| SMILES | COc1cccc(N2c3ccccc3N(CC[C@H]3CO3)S2(=O)=O)c1 |
| InChI | InChI=1S/C17H18N2O4S/c1-22-14-6-4-5-13(11-14)19-17-8-3-2-7-16(17)18(24(19,20)21)10-9-15-12-23-15/h2-8,11,15H,9-10,12H2,1H3/t15-/m0/s1 |
| InChIKey | ZNFIADBOVZYRMZ-HNNXBMFYSA-N |
| XLogP | 2.69 |
| TPSA | 62.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|