C23H15N5O — CID 46831453
4-[2-(4-cyanoanilino)quinazolin-4-yl]oxy-3-methylbenzonitrile (PubChem CID 46831453) has the molecular formula C23H15N5O and a molecular weight of 377.41 g/mol. Its IUPAC name is 4-[2-(4-cyanoanilino)quinazolin-4-yl]oxy-3-methylbenzonitrile.
| Compound Name | 4-[2-(4-cyanoanilino)quinazolin-4-yl]oxy-3-methylbenzonitrile |
|---|---|
| PubChem CID | 46831453 |
| Molecular Formula | C23H15N5O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 4-[2-(4-cyanoanilino)quinazolin-4-yl]oxy-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1Oc1nc(Nc2ccc(C#N)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H15N5O/c1-15-12-17(14-25)8-11-21(15)29-22-19-4-2-3-5-20(19)27-23(28-22)26-18-9-6-16(13-24)7-10-18/h2-12H,1H3,(H,26,27,28) |
| InChIKey | OWVILDBHEKIHFH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |