C39H39N11O2 — CID 71459773
4-[[4-[2-[[4-anilino-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile (PubChem CID 71459773) has the molecular formula C39H39N11O2 and a molecular weight of 693.82 g/mol. Its IUPAC name is 4-[[4-[2-[[4-anilino-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[2-[[4-anilino-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 71459773 |
| Molecular Formula | C39H39N11O2 |
| Molecular Weight | 693.82 g/mol |
| Exact Mass | 693.33 |
| IUPAC Name | 4-[[4-[2-[[4-anilino-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C)c(Oc2nc(NCCNc3nc(Nc4ccc(C#N)cc4)nc(Oc4c(C)cc(C)cc4C)n3)nc(Nc3ccccc3)n2)c(C)c1 |
| InChI | InChI=1S/C39H39N11O2/c1-23-18-25(3)32(26(4)19-23)51-38-47-34(45-36(49-38)43-30-10-8-7-9-11-30)41-16-17-42-35-46-37(44-31-14-12-29(22-40)13-15-31)50-39(48-35)52-33-27(5)20-24(2)21-28(33)6/h7-15,18-21H,16-17H2,1-6H3,(H2,41,43,45,47,49)(H2,42,44,46,48,50) |
| InChIKey | POYNDWHDGWOWNP-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 167.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.82 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|