C26H42O7 — CID 46833115
[(1R,2S,3R,5R,6R,7R,8R,9R,12S)-9-acetyloxy-5,12-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-3-yl] butanoate (PubChem CID 46833115) has the molecular formula C26H42O7 and a molecular weight of 466.62 g/mol. Its IUPAC name is [(1R,2S,3R,5R,6R,7R,8R,9R,12S)-9-acetyloxy-5,12-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-3-yl] butanoate.
| Compound Name | [(1R,2S,3R,5R,6R,7R,8R,9R,12S)-9-acetyloxy-5,12-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-3-yl] butanoate |
|---|---|
| PubChem CID | 46833115 |
| Molecular Formula | C26H42O7 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | [(1R,2S,3R,5R,6R,7R,8R,9R,12S)-9-acetyloxy-5,12-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-3-yl] butanoate |
| SMILES | C=C1C[C@H]2O[C@H]([C@@H]3[C@@H](C(C)C)[C@H](O)C[C@@](C)(OC(=O)CCC)[C@@H]32)[C@](C)(OC(C)=O)CC[C@@H]1O |
| InChI | InChI=1S/C26H42O7/c1-8-9-20(30)33-26(7)13-18(29)21(14(2)3)22-23(26)19-12-15(4)17(28)10-11-25(6,24(22)31-19)32-16(5)27/h14,17-19,21-24,28-29H,4,8-13H2,1-3,5-7H3/t17-,18+,19+,21-,22+,23+,24+,25+,26+/m0/s1 |
| InChIKey | YXHDJJFBUUGCHE-XWJYJYPBSA-N |
| XLogP | 3.55 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|