C26H42O7 — CID 11190529
[(1R,2R,3R,6R,7R,8R,9R,12S)-12-acetyloxy-1,9-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-3-yl] butanoate (PubChem CID 11190529) has the molecular formula C26H42O7 and a molecular weight of 466.62 g/mol. Its IUPAC name is [(1R,2R,3R,6R,7R,8R,9R,12S)-12-acetyloxy-1,9-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-3-yl] butanoate.
| Compound Name | [(1R,2R,3R,6R,7R,8R,9R,12S)-12-acetyloxy-1,9-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-3-yl] butanoate |
|---|---|
| PubChem CID | 11190529 |
| Molecular Formula | C26H42O7 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | [(1R,2R,3R,6R,7R,8R,9R,12S)-12-acetyloxy-1,9-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-3-yl] butanoate |
| SMILES | C=C1C[C@@]2(O)O[C@H]([C@@H]3[C@@H](C(C)C)CC[C@@](C)(OC(=O)CCC)[C@@H]32)[C@](C)(O)CC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H42O7/c1-8-9-20(28)32-25(7)13-10-18(15(2)3)21-22(25)26(30)14-16(4)19(31-17(5)27)11-12-24(6,29)23(21)33-26/h15,18-19,21-23,29-30H,4,8-14H2,1-3,5-7H3/t18-,19+,21-,22-,23-,24-,25-,26-/m1/s1 |
| InChIKey | MOLHYXXXUDUQTC-HSKZKXPYSA-N |
| XLogP | 3.90 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|