About dichloroplatinum;bis(pyridine-3-carbonitrile)
dichloroplatinum;bis(pyridine-3-carbonitrile) (PubChem CID 4683431) has the molecular formula C12H8Cl2N4Pt
and a molecular weight of 474.21 g/mol. Its IUPAC name is dichloroplatinum;bis(pyridine-3-carbonitrile).
Molecular Properties
| Compound Name | dichloroplatinum;bis(pyridine-3-carbonitrile) |
| PubChem CID | 4683431 |
| Molecular Formula | C12H8Cl2N4Pt |
| Molecular Weight | 474.21 g/mol |
| Exact Mass | 472.98 |
| IUPAC Name | dichloroplatinum;bis(pyridine-3-carbonitrile) |
| SMILES | Cl[Pt]Cl.N#Cc1cccnc1.N#Cc1cccnc1 |
| InChI | InChI=1S/2C6H4N2.2ClH.Pt/c2*7-4-6-2-1-3-8-5-6;;;/h2*1-3,5H;2*1H;/q;;;;+2/p-2 |
| InChIKey | NSGBASBEDNWFSY-UHFFFAOYSA-L |
| XLogP | 3.28 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dichloroplatinum;bis(pyridine-3-carbonitrile) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;bis(pyridine-3-carbonitrile)?
The IUPAC name of dichloroplatinum;bis(pyridine-3-carbonitrile) (CID 4683431) is dichloroplatinum;bis(pyridine-3-carbonitrile).
What is the SMILES notation for dichloroplatinum;bis(pyridine-3-carbonitrile)?
The canonical SMILES for dichloroplatinum;bis(pyridine-3-carbonitrile) is Cl[Pt]Cl.N#Cc1cccnc1.N#Cc1cccnc1.
What is the InChIKey of dichloroplatinum;bis(pyridine-3-carbonitrile)?
The InChIKey is NSGBASBEDNWFSY-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H4N2.2ClH.Pt/c2*7-4-6-2-1-3-8-5-6;;;/h2*1-3,5H;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloroplatinum;bis(pyridine-3-carbonitrile)?
dichloroplatinum;bis(pyridine-3-carbonitrile) has a molecular weight of 474.21 g/mol, XLogP of 3.28, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;bis(pyridine-3-carbonitrile) is sourced from PubChem (CID 4683431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).