C6H10S2 — CID 46835320
hexa-1,5-diene-3,4-dithiol (PubChem CID 46835320) has the molecular formula C6H10S2 and a molecular weight of 146.28 g/mol. Its IUPAC name is hexa-1,5-diene-3,4-dithiol.
| Compound Name | hexa-1,5-diene-3,4-dithiol |
|---|---|
| PubChem CID | 46835320 |
| Molecular Formula | C6H10S2 |
| Molecular Weight | 146.28 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | hexa-1,5-diene-3,4-dithiol |
| SMILES | C=CC(S)C(S)C=C |
| InChI | InChI=1S/C6H10S2/c1-3-5(7)6(8)4-2/h3-8H,1-2H2 |
| InChIKey | WHSNQWMIYBTVHE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|