C16H16ClNO3S — CID 46836201
(5Z)-5-[(3-chloro-4-cyclohexyloxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 46836201) has the molecular formula C16H16ClNO3S and a molecular weight of 337.83 g/mol. Its IUPAC name is (5Z)-5-[(3-chloro-4-cyclohexyloxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3-chloro-4-cyclohexyloxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 46836201 |
| Molecular Formula | C16H16ClNO3S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | (5Z)-5-[(3-chloro-4-cyclohexyloxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(OC3CCCCC3)c(Cl)c2)S1 |
| InChI | InChI=1S/C16H16ClNO3S/c17-12-8-10(9-14-15(19)18-16(20)22-14)6-7-13(12)21-11-4-2-1-3-5-11/h6-9,11H,1-5H2,(H,18,19,20)/b14-9- |
| InChIKey | DKEZSRKQXRFEHX-ZROIWOOFSA-N |
| XLogP | 4.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|