C13H15N3O2 — CID 46837358
4-amino-N-(2,5-dimethylpyrrol-1-yl)-2-hydroxybenzamide (PubChem CID 46837358) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-amino-N-(2,5-dimethylpyrrol-1-yl)-2-hydroxybenzamide.
| Compound Name | 4-amino-N-(2,5-dimethylpyrrol-1-yl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 46837358 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-amino-N-(2,5-dimethylpyrrol-1-yl)-2-hydroxybenzamide |
| SMILES | Cc1ccc(C)n1NC(=O)c1ccc(N)cc1O |
| InChI | InChI=1S/C13H15N3O2/c1-8-3-4-9(2)16(8)15-13(18)11-6-5-10(14)7-12(11)17/h3-7,17H,14H2,1-2H3,(H,15,18) |
| InChIKey | RPBYOYPQAFRPSP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|