About 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one
4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one (PubChem CID 46837479) has the molecular formula C15H14Cl2O3
and a molecular weight of 313.18 g/mol. Its IUPAC name is 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one.
Molecular Properties
| Compound Name | 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one |
| PubChem CID | 46837479 |
| Molecular Formula | C15H14Cl2O3 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one |
| SMILES | Cc1cc(Cl)c(/C(Cl)=C/C=C2/CCCCC2=O)c(=O)o1 |
| InChI | InChI=1S/C15H14Cl2O3/c1-9-8-12(17)14(15(19)20-9)11(16)7-6-10-4-2-3-5-13(10)18/h6-8H,2-5H2,1H3/b10-6-,11-7- |
| InChIKey | QLJZOMUTZPUINS-SQXCDDPUSA-N |
| XLogP | 4.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one?
The IUPAC name of 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one (CID 46837479) is 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one.
What is the SMILES notation for 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one?
The canonical SMILES for 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one is Cc1cc(Cl)c(/C(Cl)=C/C=C2/CCCCC2=O)c(=O)o1.
What is the InChIKey of 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one?
The InChIKey is QLJZOMUTZPUINS-SQXCDDPUSA-N. The full InChI is InChI=1S/C15H14Cl2O3/c1-9-8-12(17)14(15(19)20-9)11(16)7-6-10-4-2-3-5-13(10)18/h6-8H,2-5H2,1H3/b10-6-,11-7-.
What are the key properties of 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one?
4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one has a molecular weight of 313.18 g/mol, XLogP of 4.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclohexylidene)prop-1-enyl]-6-methylpyran-2-one is sourced from PubChem (CID 46837479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).