C14H12Cl2O3 — CID 46837480
4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclopentylidene)prop-1-enyl]-6-methylpyran-2-one (PubChem CID 46837480) has the molecular formula C14H12Cl2O3 and a molecular weight of 299.15 g/mol. Its IUPAC name is 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclopentylidene)prop-1-enyl]-6-methylpyran-2-one.
| Compound Name | 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclopentylidene)prop-1-enyl]-6-methylpyran-2-one |
|---|---|
| PubChem CID | 46837480 |
| Molecular Formula | C14H12Cl2O3 |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 4-chloro-3-[(Z,3Z)-1-chloro-3-(2-oxocyclopentylidene)prop-1-enyl]-6-methylpyran-2-one |
| SMILES | Cc1cc(Cl)c(/C(Cl)=C/C=C2/CCCC2=O)c(=O)o1 |
| InChI | InChI=1S/C14H12Cl2O3/c1-8-7-11(16)13(14(18)19-8)10(15)6-5-9-3-2-4-12(9)17/h5-7H,2-4H2,1H3/b9-5-,10-6- |
| InChIKey | KUPREABDHAIFFZ-OZDSWYPASA-N |
| XLogP | 3.86 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|