C20H34N2O4S — CID 46838058
2-[4,6-bis(3-methylbutoxy)pyrimidin-2-yl]sulfanylhexanoic acid (PubChem CID 46838058) has the molecular formula C20H34N2O4S and a molecular weight of 398.57 g/mol. Its IUPAC name is 2-[4,6-bis(3-methylbutoxy)pyrimidin-2-yl]sulfanylhexanoic acid.
| Compound Name | 2-[4,6-bis(3-methylbutoxy)pyrimidin-2-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 46838058 |
| Molecular Formula | C20H34N2O4S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-[4,6-bis(3-methylbutoxy)pyrimidin-2-yl]sulfanylhexanoic acid |
| SMILES | CCCCC(Sc1nc(OCCC(C)C)cc(OCCC(C)C)n1)C(=O)O |
| InChI | InChI=1S/C20H34N2O4S/c1-6-7-8-16(19(23)24)27-20-21-17(25-11-9-14(2)3)13-18(22-20)26-12-10-15(4)5/h13-16H,6-12H2,1-5H3,(H,23,24) |
| InChIKey | NXNTUEAGQHEFGJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |