C19H17BrN2O4 — CID 46839013
methyl 6-(5-bromo-2-hydroxyphenyl)-4-methyl-2-oxo-3-phenyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 46839013) has the molecular formula C19H17BrN2O4 and a molecular weight of 417.26 g/mol. Its IUPAC name is methyl 6-(5-bromo-2-hydroxyphenyl)-4-methyl-2-oxo-3-phenyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 6-(5-bromo-2-hydroxyphenyl)-4-methyl-2-oxo-3-phenyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 46839013 |
| Molecular Formula | C19H17BrN2O4 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | methyl 6-(5-bromo-2-hydroxyphenyl)-4-methyl-2-oxo-3-phenyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccccc2)C(=O)NC1c1cc(Br)ccc1O |
| InChI | InChI=1S/C19H17BrN2O4/c1-11-16(18(24)26-2)17(14-10-12(20)8-9-15(14)23)21-19(25)22(11)13-6-4-3-5-7-13/h3-10,17,23H,1-2H3,(H,21,25) |
| InChIKey | FPNYOVVVXANIMU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|