C19H16F2N2O2S — CID 7939304
methyl (6R)-6-(2,4-difluorophenyl)-4-methyl-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 7939304) has the molecular formula C19H16F2N2O2S and a molecular weight of 374.41 g/mol. Its IUPAC name is methyl (6R)-6-(2,4-difluorophenyl)-4-methyl-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl (6R)-6-(2,4-difluorophenyl)-4-methyl-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 7939304 |
| Molecular Formula | C19H16F2N2O2S |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | methyl (6R)-6-(2,4-difluorophenyl)-4-methyl-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccccc2)C(=S)N[C@H]1c1ccc(F)cc1F |
| InChI | InChI=1S/C19H16F2N2O2S/c1-11-16(18(24)25-2)17(14-9-8-12(20)10-15(14)21)22-19(26)23(11)13-6-4-3-5-7-13/h3-10,17H,1-2H3,(H,22,26)/t17-/m0/s1 |
| InChIKey | RQAQOWNMQQNMON-KRWDZBQOSA-N |
| XLogP | 3.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|