C8H8N4OS — CID 46839740
3-(5-methoxy-2-pyridinyl)-1,2,4-thiadiazol-5-amine (PubChem CID 46839740) has the molecular formula C8H8N4OS and a molecular weight of 208.25 g/mol. Its IUPAC name is 3-(5-methoxy-2-pyridinyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(5-methoxy-2-pyridinyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 46839740 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 3-(5-methoxy-2-pyridinyl)-1,2,4-thiadiazol-5-amine |
| SMILES | COc1ccc(-c2nsc(N)n2)nc1 |
| InChI | InChI=1S/C8H8N4OS/c1-13-5-2-3-6(10-4-5)7-11-8(9)14-12-7/h2-4H,1H3,(H2,9,11,12) |
| InChIKey | VUXZOLYLSMERMK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |