C9H10ClN3OS — CID 75485647
3-(3-methoxyphenyl)-1,2,4-thiadiazol-5-amine;hydrochloride (PubChem CID 75485647) has the molecular formula C9H10ClN3OS and a molecular weight of 243.72 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-1,2,4-thiadiazol-5-amine;hydrochloride.
| Compound Name | 3-(3-methoxyphenyl)-1,2,4-thiadiazol-5-amine;hydrochloride |
|---|---|
| PubChem CID | 75485647 |
| Molecular Formula | C9H10ClN3OS |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 3-(3-methoxyphenyl)-1,2,4-thiadiazol-5-amine;hydrochloride |
| SMILES | COc1cccc(-c2nsc(N)n2)c1.Cl |
| InChI | InChI=1S/C9H9N3OS.ClH/c1-13-7-4-2-3-6(5-7)8-11-9(10)14-12-8;/h2-5H,1H3,(H2,10,11,12);1H |
| InChIKey | IIHQBDONHZBBDI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |