C19H18Cl2N2O+2 — CID 46841453
(2Z,5Z)-2,5-bis[(6-chloro-1-methylpyridin-1-ium-3-yl)methylidene]cyclopentan-1-one (PubChem CID 46841453) has the molecular formula C19H18Cl2N2O+2 and a molecular weight of 361.27 g/mol. Its IUPAC name is (2Z,5Z)-2,5-bis[(6-chloro-1-methylpyridin-1-ium-3-yl)methylidene]cyclopentan-1-one.
| Compound Name | (2Z,5Z)-2,5-bis[(6-chloro-1-methylpyridin-1-ium-3-yl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 46841453 |
| Molecular Formula | C19H18Cl2N2O+2 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (2Z,5Z)-2,5-bis[(6-chloro-1-methylpyridin-1-ium-3-yl)methylidene]cyclopentan-1-one |
| SMILES | C[n+]1cc(/C=C2/CC/C(=C/c3ccc(Cl)[n+](C)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C19H18Cl2N2O/c1-22-11-13(3-7-17(22)20)9-15-5-6-16(19(15)24)10-14-4-8-18(21)23(2)12-14/h3-4,7-12H,5-6H2,1-2H3/q+2/b15-9-,16-10- |
| InChIKey | LNCNHMPVNDFRLH-VULZFCBJSA-N |
| XLogP | 3.47 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|