C13H15NO2 — CID 46841654
(E,1E)-4-(4-ethylphenyl)-1-methoxyiminobut-3-en-2-one (PubChem CID 46841654) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (E,1E)-4-(4-ethylphenyl)-1-methoxyiminobut-3-en-2-one.
| Compound Name | (E,1E)-4-(4-ethylphenyl)-1-methoxyiminobut-3-en-2-one |
|---|---|
| PubChem CID | 46841654 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (E,1E)-4-(4-ethylphenyl)-1-methoxyiminobut-3-en-2-one |
| SMILES | CCc1ccc(/C=C/C(=O)/C=N/OC)cc1 |
| InChI | InChI=1S/C13H15NO2/c1-3-11-4-6-12(7-5-11)8-9-13(15)10-14-16-2/h4-10H,3H2,1-2H3/b9-8+,14-10+ |
| InChIKey | GYZWNDCGUHZIDH-ANVLWLQNSA-N |
| XLogP | 2.46 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|