C24H36O3 — CID 46842460
(6aR,10aR)-6a,7,7,8,8,10,10,10a-octadeuterio-1-hydroxy-3-(2-methyloctan-2-yl)-6,6-bis(trideuteriomethyl)benzo[c]chromen-9-one (PubChem CID 46842460) has the molecular formula C24H36O3 and a molecular weight of 386.63 g/mol. Its IUPAC name is (6aR,10aR)-6a,7,7,8,8,10,10,10a-octadeuterio-1-hydroxy-3-(2-methyloctan-2-yl)-6,6-bis(trideuteriomethyl)benzo[c]chromen-9-one.
| Compound Name | (6aR,10aR)-6a,7,7,8,8,10,10,10a-octadeuterio-1-hydroxy-3-(2-methyloctan-2-yl)-6,6-bis(trideuteriomethyl)benzo[c]chromen-9-one |
|---|---|
| PubChem CID | 46842460 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.35 |
| IUPAC Name | (6aR,10aR)-6a,7,7,8,8,10,10,10a-octadeuterio-1-hydroxy-3-(2-methyloctan-2-yl)-6,6-bis(trideuteriomethyl)benzo[c]chromen-9-one |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])Oc2cc(C(C)(C)CCCCCC)cc(O)c2[C@]2([2H])C([2H])([2H])C(=O)C([2H])([2H])C([2H])([2H])[C@@]12[2H] |
| InChI | InChI=1S/C24H36O3/c1-6-7-8-9-12-23(2,3)16-13-20(26)22-18-15-17(25)10-11-19(18)24(4,5)27-21(22)14-16/h13-14,18-19,26H,6-12,15H2,1-5H3/t18-,19-/m1/s1/i4D3,5D3,10D2,11D2,15D2,18D,19D |
| InChIKey | GECBBEABIDMGGL-VOWAIEPFSA-N |
| XLogP | 6.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|