C6H14O — CID 46844235
(2R)-2,5,6-trideuteriohexan-1-ol (PubChem CID 46844235) has the molecular formula C6H14O and a molecular weight of 105.20 g/mol. Its IUPAC name is (2R)-2,5,6-trideuteriohexan-1-ol.
| Compound Name | (2R)-2,5,6-trideuteriohexan-1-ol |
|---|---|
| PubChem CID | 46844235 |
| Molecular Formula | C6H14O |
| Molecular Weight | 105.20 g/mol |
| Exact Mass | 105.12 |
| IUPAC Name | (2R)-2,5,6-trideuteriohexan-1-ol |
| SMILES | [2H]CC([2H])CC[C@@H]([2H])CO |
| InChI | InChI=1S/C6H14O/c1-2-3-4-5-6-7/h7H,2-6H2,1H3/i1D,2D,5D/t2?,5-/m1/s1 |
| InChIKey | ZSIAUFGUXNUGDI-DBSIKJIBSA-N |
| XLogP | 1.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 105.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |