C18H32O5 — CID 46844935
(1S,5R,7R,9R,11S,13S)-13-hydroxy-7-methoxy-9-methyl-5-propyl-4,15-dioxabicyclo[9.3.1]pentadecan-3-one (PubChem CID 46844935) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (1S,5R,7R,9R,11S,13S)-13-hydroxy-7-methoxy-9-methyl-5-propyl-4,15-dioxabicyclo[9.3.1]pentadecan-3-one.
| Compound Name | (1S,5R,7R,9R,11S,13S)-13-hydroxy-7-methoxy-9-methyl-5-propyl-4,15-dioxabicyclo[9.3.1]pentadecan-3-one |
|---|---|
| PubChem CID | 46844935 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (1S,5R,7R,9R,11S,13S)-13-hydroxy-7-methoxy-9-methyl-5-propyl-4,15-dioxabicyclo[9.3.1]pentadecan-3-one |
| SMILES | CCC[C@@H]1C[C@H](OC)C[C@@H](C)C[C@H]2C[C@H](O)C[C@@H](CC(=O)O1)O2 |
| InChI | InChI=1S/C18H32O5/c1-4-5-14-10-15(21-3)6-12(2)7-16-8-13(19)9-17(22-16)11-18(20)23-14/h12-17,19H,4-11H2,1-3H3/t12-,13+,14-,15-,16+,17+/m1/s1 |
| InChIKey | CVACZTHIJGBAFT-NEMWNAMBSA-N |
| XLogP | 2.83 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |