C15H17F2N3O2S3 — CID 4684578
3-(acetamidomethylsulfanyl)-N-[2-(2,2-difluoroethylsulfanyl)-1,3-benzothiazol-6-yl]propanamide (PubChem CID 4684578) has the molecular formula C15H17F2N3O2S3 and a molecular weight of 405.52 g/mol. Its IUPAC name is 3-(acetamidomethylsulfanyl)-N-[2-(2,2-difluoroethylsulfanyl)-1,3-benzothiazol-6-yl]propanamide.
| Compound Name | 3-(acetamidomethylsulfanyl)-N-[2-(2,2-difluoroethylsulfanyl)-1,3-benzothiazol-6-yl]propanamide |
|---|---|
| PubChem CID | 4684578 |
| Molecular Formula | C15H17F2N3O2S3 |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 3-(acetamidomethylsulfanyl)-N-[2-(2,2-difluoroethylsulfanyl)-1,3-benzothiazol-6-yl]propanamide |
| SMILES | CC(=O)NCSCCC(=O)Nc1ccc2nc(SCC(F)F)sc2c1 |
| InChI | InChI=1S/C15H17F2N3O2S3/c1-9(21)18-8-23-5-4-14(22)19-10-2-3-11-12(6-10)25-15(20-11)24-7-13(16)17/h2-3,6,13H,4-5,7-8H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | HMYTVHGPUZNCLC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|