C15H20O5 — CID 46845927
diethyl 3-methyl-4-oxo-3a,5,6,6a-tetrahydropentalene-1,1-dicarboxylate (PubChem CID 46845927) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is diethyl 3-methyl-4-oxo-3a,5,6,6a-tetrahydropentalene-1,1-dicarboxylate.
| Compound Name | diethyl 3-methyl-4-oxo-3a,5,6,6a-tetrahydropentalene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 46845927 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | diethyl 3-methyl-4-oxo-3a,5,6,6a-tetrahydropentalene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C=C(C)C2C(=O)CCC21 |
| InChI | InChI=1S/C15H20O5/c1-4-19-13(17)15(14(18)20-5-2)8-9(3)12-10(15)6-7-11(12)16/h8,10,12H,4-7H2,1-3H3 |
| InChIKey | BSKAMYQKFAQSSW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|