C24H48O5Si2 — CID 46846107
2-trimethylsilylethyl (E,7S,9R)-7-acetyloxy-3-methyl-9-triethylsilyloxydec-2-enoate (PubChem CID 46846107) has the molecular formula C24H48O5Si2 and a molecular weight of 472.82 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E,7S,9R)-7-acetyloxy-3-methyl-9-triethylsilyloxydec-2-enoate.
| Compound Name | 2-trimethylsilylethyl (E,7S,9R)-7-acetyloxy-3-methyl-9-triethylsilyloxydec-2-enoate |
|---|---|
| PubChem CID | 46846107 |
| Molecular Formula | C24H48O5Si2 |
| Molecular Weight | 472.82 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 2-trimethylsilylethyl (E,7S,9R)-7-acetyloxy-3-methyl-9-triethylsilyloxydec-2-enoate |
| SMILES | CC[Si](CC)(CC)O[C@H](C)C[C@H](CCC/C(C)=C/C(=O)OCC[Si](C)(C)C)OC(C)=O |
| InChI | InChI=1S/C24H48O5Si2/c1-10-31(11-2,12-3)29-21(5)19-23(28-22(6)25)15-13-14-20(4)18-24(26)27-16-17-30(7,8)9/h18,21,23H,10-17,19H2,1-9H3/b20-18+/t21-,23+/m1/s1 |
| InChIKey | DTWLCIRMTNQRBE-OPFGUVMXSA-N |
| XLogP | 6.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.82 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|