C23H19N3OS — CID 46849030
N-(4-methylphenyl)-3-phenyl-4-phenylsulfanyl-1H-pyrazole-5-carboxamide (PubChem CID 46849030) has the molecular formula C23H19N3OS and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(4-methylphenyl)-3-phenyl-4-phenylsulfanyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-(4-methylphenyl)-3-phenyl-4-phenylsulfanyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 46849030 |
| Molecular Formula | C23H19N3OS |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-(4-methylphenyl)-3-phenyl-4-phenylsulfanyl-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2[nH]nc(-c3ccccc3)c2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N3OS/c1-16-12-14-18(15-13-16)24-23(27)21-22(28-19-10-6-3-7-11-19)20(25-26-21)17-8-4-2-5-9-17/h2-15H,1H3,(H,24,27)(H,25,26) |
| InChIKey | ZHVKHIKSWRXYFF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |