C36H40N4O6S2 — CID 46852630
2-N,7-N-dibenzyl-2-N,7-N-bis[2-(dimethylamino)ethyl]-9,10-dioxoanthracene-2,7-disulfonamide (PubChem CID 46852630) has the molecular formula C36H40N4O6S2 and a molecular weight of 688.87 g/mol. Its IUPAC name is 2-N,7-N-dibenzyl-2-N,7-N-bis[2-(dimethylamino)ethyl]-9,10-dioxoanthracene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-dibenzyl-2-N,7-N-bis[2-(dimethylamino)ethyl]-9,10-dioxoanthracene-2,7-disulfonamide |
|---|---|
| PubChem CID | 46852630 |
| Molecular Formula | C36H40N4O6S2 |
| Molecular Weight | 688.87 g/mol |
| Exact Mass | 688.24 |
| IUPAC Name | 2-N,7-N-dibenzyl-2-N,7-N-bis[2-(dimethylamino)ethyl]-9,10-dioxoanthracene-2,7-disulfonamide |
| SMILES | CN(C)CCN(Cc1ccccc1)S(=O)(=O)c1ccc2c(c1)C(=O)c1cc(S(=O)(=O)N(CCN(C)C)Cc3ccccc3)ccc1C2=O |
| InChI | InChI=1S/C36H40N4O6S2/c1-37(2)19-21-39(25-27-11-7-5-8-12-27)47(43,44)29-15-17-31-33(23-29)36(42)34-24-30(16-18-32(34)35(31)41)48(45,46)40(22-20-38(3)4)26-28-13-9-6-10-14-28/h5-18,23-24H,19-22,25-26H2,1-4H3 |
| InChIKey | VKNIXMBNUDYUAM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 115.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.87 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|