C21H25NO4 — CID 46854256
dimethyl 1-[(1R)-1-naphthalen-2-ylethyl]piperidine-4,4-dicarboxylate (PubChem CID 46854256) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is dimethyl 1-[(1R)-1-naphthalen-2-ylethyl]piperidine-4,4-dicarboxylate.
| Compound Name | dimethyl 1-[(1R)-1-naphthalen-2-ylethyl]piperidine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 46854256 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | dimethyl 1-[(1R)-1-naphthalen-2-ylethyl]piperidine-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CCN([C@H](C)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C21H25NO4/c1-15(17-9-8-16-6-4-5-7-18(16)14-17)22-12-10-21(11-13-22,19(23)25-2)20(24)26-3/h4-9,14-15H,10-13H2,1-3H3/t15-/m1/s1 |
| InChIKey | AZAOMOYRACXESB-OAHLLOKOSA-N |
| XLogP | 3.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|