C15H19FN4O2 — CID 46858088
1-(3-fluoro-4-methylphenyl)-N-(3-methoxypropyl)-5-methyltriazole-4-carboxamide (PubChem CID 46858088) has the molecular formula C15H19FN4O2 and a molecular weight of 306.34 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-N-(3-methoxypropyl)-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-N-(3-methoxypropyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 46858088 |
| Molecular Formula | C15H19FN4O2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-N-(3-methoxypropyl)-5-methyltriazole-4-carboxamide |
| SMILES | COCCCNC(=O)c1nnn(-c2ccc(C)c(F)c2)c1C |
| InChI | InChI=1S/C15H19FN4O2/c1-10-5-6-12(9-13(10)16)20-11(2)14(18-19-20)15(21)17-7-4-8-22-3/h5-6,9H,4,7-8H2,1-3H3,(H,17,21) |
| InChIKey | WFRRRHUBAWETCG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|