C16H22N4O — CID 27234925
N-butyl-1-(3,5-dimethylphenyl)-5-methyltriazole-4-carboxamide (PubChem CID 27234925) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is N-butyl-1-(3,5-dimethylphenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | N-butyl-1-(3,5-dimethylphenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 27234925 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | N-butyl-1-(3,5-dimethylphenyl)-5-methyltriazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1nnn(-c2cc(C)cc(C)c2)c1C |
| InChI | InChI=1S/C16H22N4O/c1-5-6-7-17-16(21)15-13(4)20(19-18-15)14-9-11(2)8-12(3)10-14/h8-10H,5-7H2,1-4H3,(H,17,21) |
| InChIKey | XJXODLXRALSKQY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|