C19H21N3OS — CID 46859241
1-[4-methyl-2-(3-phenyl-3,3a,4,5,6,7-hexahydroindazol-2-yl)-1,3-thiazol-5-yl]ethanone (PubChem CID 46859241) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-[4-methyl-2-(3-phenyl-3,3a,4,5,6,7-hexahydroindazol-2-yl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[4-methyl-2-(3-phenyl-3,3a,4,5,6,7-hexahydroindazol-2-yl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 46859241 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-[4-methyl-2-(3-phenyl-3,3a,4,5,6,7-hexahydroindazol-2-yl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1sc(N2N=C3CCCCC3C2c2ccccc2)nc1C |
| InChI | InChI=1S/C19H21N3OS/c1-12-18(13(2)23)24-19(20-12)22-17(14-8-4-3-5-9-14)15-10-6-7-11-16(15)21-22/h3-5,8-9,15,17H,6-7,10-11H2,1-2H3 |
| InChIKey | DXUVNKYHCBBCPO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |