C16H16F4N4O3S2 — CID 46861804
N-(4-aminobutyl)-5-sulfamoyl-2-(2,3,5,6-tetrafluorophenyl)sulfanylpyridine-3-carboxamide (PubChem CID 46861804) has the molecular formula C16H16F4N4O3S2 and a molecular weight of 452.46 g/mol. Its IUPAC name is N-(4-aminobutyl)-5-sulfamoyl-2-(2,3,5,6-tetrafluorophenyl)sulfanylpyridine-3-carboxamide.
| Compound Name | N-(4-aminobutyl)-5-sulfamoyl-2-(2,3,5,6-tetrafluorophenyl)sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46861804 |
| Molecular Formula | C16H16F4N4O3S2 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | N-(4-aminobutyl)-5-sulfamoyl-2-(2,3,5,6-tetrafluorophenyl)sulfanylpyridine-3-carboxamide |
| SMILES | NCCCCNC(=O)c1cc(S(N)(=O)=O)cnc1Sc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C16H16F4N4O3S2/c17-10-6-11(18)13(20)14(12(10)19)28-16-9(15(25)23-4-2-1-3-21)5-8(7-24-16)29(22,26)27/h5-7H,1-4,21H2,(H,23,25)(H2,22,26,27) |
| InChIKey | QGHOBAGZKQWLLO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|