C23H20N2O2 — CID 46862007
benzyl 4,5-diphenyl-3,4-dihydropyrazole-2-carboxylate (PubChem CID 46862007) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is benzyl 4,5-diphenyl-3,4-dihydropyrazole-2-carboxylate.
| Compound Name | benzyl 4,5-diphenyl-3,4-dihydropyrazole-2-carboxylate |
|---|---|
| PubChem CID | 46862007 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | benzyl 4,5-diphenyl-3,4-dihydropyrazole-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC(c2ccccc2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C23H20N2O2/c26-23(27-17-18-10-4-1-5-11-18)25-16-21(19-12-6-2-7-13-19)22(24-25)20-14-8-3-9-15-20/h1-15,21H,16-17H2 |
| InChIKey | DWTZWYGEXXHPIV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |