C19H16N6O3 — CID 46862383
5-[3-ethoxy-7-(4-methoxyphenyl)imidazo[1,2-b][1,2,4,5]tetrazin-6-yl]pyridine-3-carbaldehyde (PubChem CID 46862383) has the molecular formula C19H16N6O3 and a molecular weight of 376.38 g/mol. Its IUPAC name is 5-[3-ethoxy-7-(4-methoxyphenyl)imidazo[1,2-b][1,2,4,5]tetrazin-6-yl]pyridine-3-carbaldehyde.
| Compound Name | 5-[3-ethoxy-7-(4-methoxyphenyl)imidazo[1,2-b][1,2,4,5]tetrazin-6-yl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 46862383 |
| Molecular Formula | C19H16N6O3 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 5-[3-ethoxy-7-(4-methoxyphenyl)imidazo[1,2-b][1,2,4,5]tetrazin-6-yl]pyridine-3-carbaldehyde |
| SMILES | CCOc1nnc2nc(-c3ccc(OC)cc3)c(-c3cncc(C=O)c3)n2n1 |
| InChI | InChI=1S/C19H16N6O3/c1-3-28-19-23-22-18-21-16(13-4-6-15(27-2)7-5-13)17(25(18)24-19)14-8-12(11-26)9-20-10-14/h4-11H,3H2,1-2H3 |
| InChIKey | NLPPRHBTSVOXBC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|