C21H38N4O3 — CID 46862718
[3-[4-[(dibutylamino)methyl]triazol-1-yl]-2-hydroxypropyl] cyclohexanecarboxylate (PubChem CID 46862718) has the molecular formula C21H38N4O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is [3-[4-[(dibutylamino)methyl]triazol-1-yl]-2-hydroxypropyl] cyclohexanecarboxylate.
| Compound Name | [3-[4-[(dibutylamino)methyl]triazol-1-yl]-2-hydroxypropyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 46862718 |
| Molecular Formula | C21H38N4O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | [3-[4-[(dibutylamino)methyl]triazol-1-yl]-2-hydroxypropyl] cyclohexanecarboxylate |
| SMILES | CCCCN(CCCC)Cc1cn(CC(O)COC(=O)C2CCCCC2)nn1 |
| InChI | InChI=1S/C21H38N4O3/c1-3-5-12-24(13-6-4-2)14-19-15-25(23-22-19)16-20(26)17-28-21(27)18-10-8-7-9-11-18/h15,18,20,26H,3-14,16-17H2,1-2H3 |
| InChIKey | UCOZNZCDOWBCEI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |