C25H26ClN5OS — CID 46864519
2-N-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-6-N,6-N-dimethyl-4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (PubChem CID 46864519) has the molecular formula C25H26ClN5OS and a molecular weight of 480.04 g/mol. Its IUPAC name is 2-N-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-6-N,6-N-dimethyl-4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-6-N,6-N-dimethyl-4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 46864519 |
| Molecular Formula | C25H26ClN5OS |
| Molecular Weight | 480.04 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 2-N-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-6-N,6-N-dimethyl-4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| SMILES | COc1cc(Nc2nc3c(s2)CC(N(C)C)CC3c2ccccc2)ccc1-n1cnc(Cl)c1 |
| InChI | InChI=1S/C25H26ClN5OS/c1-30(2)18-12-19(16-7-5-4-6-8-16)24-22(13-18)33-25(29-24)28-17-9-10-20(21(11-17)32-3)31-14-23(26)27-15-31/h4-11,14-15,18-19H,12-13H2,1-3H3,(H,28,29) |
| InChIKey | PSHZSHKBNGVRJH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.04 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |