C23H23ClN4OS — CID 88984142
(4S)-N-[4-(4-chloro-4,5-dihydroimidazol-1-yl)-3-methoxyphenyl]-4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (PubChem CID 88984142) has the molecular formula C23H23ClN4OS and a molecular weight of 438.98 g/mol. Its IUPAC name is (4S)-N-[4-(4-chloro-4,5-dihydroimidazol-1-yl)-3-methoxyphenyl]-4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine.
| Compound Name | (4S)-N-[4-(4-chloro-4,5-dihydroimidazol-1-yl)-3-methoxyphenyl]-4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 88984142 |
| Molecular Formula | C23H23ClN4OS |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | (4S)-N-[4-(4-chloro-4,5-dihydroimidazol-1-yl)-3-methoxyphenyl]-4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| SMILES | COc1cc(Nc2nc3c(s2)CCC[C@H]3c2ccccc2)ccc1N1C=NC(Cl)C1 |
| InChI | InChI=1S/C23H23ClN4OS/c1-29-19-12-16(10-11-18(19)28-13-21(24)25-14-28)26-23-27-22-17(8-5-9-20(22)30-23)15-6-3-2-4-7-15/h2-4,6-7,10-12,14,17,21H,5,8-9,13H2,1H3,(H,26,27)/t17-,21?/m0/s1 |
| InChIKey | OSPIFQHAPVHJQK-PBVYKCSPSA-N |
| XLogP | 5.78 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|