C22H17ClFN7 — CID 46864631
2-(4-chloroimidazol-1-yl)-5-[[8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzonitrile (PubChem CID 46864631) has the molecular formula C22H17ClFN7 and a molecular weight of 433.88 g/mol. Its IUPAC name is 2-(4-chloroimidazol-1-yl)-5-[[8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzonitrile.
| Compound Name | 2-(4-chloroimidazol-1-yl)-5-[[8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 46864631 |
| Molecular Formula | C22H17ClFN7 |
| Molecular Weight | 433.88 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-(4-chloroimidazol-1-yl)-5-[[8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1cc(Nc2nc3n(n2)CCCC3c2ccc(F)cc2)ccc1-n1cnc(Cl)c1 |
| InChI | InChI=1S/C22H17ClFN7/c23-20-12-30(13-26-20)19-8-7-17(10-15(19)11-25)27-22-28-21-18(2-1-9-31(21)29-22)14-3-5-16(24)6-4-14/h3-8,10,12-13,18H,1-2,9H2,(H,27,29) |
| InChIKey | BVCWYGUUPRWTEA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 84.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.88 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |