C22H20F2N6 — CID 46864635
(8R)-N-[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]-8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 46864635) has the molecular formula C22H20F2N6 and a molecular weight of 406.44 g/mol. Its IUPAC name is (8R)-N-[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]-8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | (8R)-N-[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]-8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 46864635 |
| Molecular Formula | C22H20F2N6 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (8R)-N-[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]-8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nccn1-c1ccc(Nc2nc3n(n2)CCC[C@@H]3c2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C22H20F2N6/c1-14-25-10-12-29(14)20-9-8-17(13-19(20)24)26-22-27-21-18(3-2-11-30(21)28-22)15-4-6-16(23)7-5-15/h4-10,12-13,18H,2-3,11H2,1H3,(H,26,28)/t18-/m1/s1 |
| InChIKey | NBOQOAWQTSXSLN-GOSISDBHSA-N |
| XLogP | 4.72 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |